About azepane;triethoxysilane
azepane;triethoxysilane (PubChem CID 173012109) has the molecular formula C12H29NO3Si
and a molecular weight of 263.45 g/mol. Its IUPAC name is azepane;triethoxysilane.
Molecular Properties
| Compound Name | azepane;triethoxysilane |
| PubChem CID | 173012109 |
| Molecular Formula | C12H29NO3Si |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | azepane;triethoxysilane |
| SMILES | C1CCCNCC1.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H13N.C6H16O3Si/c1-2-4-6-7-5-3-1;1-4-7-10(8-5-2)9-6-3/h7H,1-6H2;10H,4-6H2,1-3H3 |
| InChIKey | OESJIOXQTORHSW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azepane;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane;triethoxysilane?
The IUPAC name of azepane;triethoxysilane (CID 173012109) is azepane;triethoxysilane.
What is the SMILES notation for azepane;triethoxysilane?
The canonical SMILES for azepane;triethoxysilane is C1CCCNCC1.CCO[SiH](OCC)OCC.
What is the InChIKey of azepane;triethoxysilane?
The InChIKey is OESJIOXQTORHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C6H16O3Si/c1-2-4-6-7-5-3-1;1-4-7-10(8-5-2)9-6-3/h7H,1-6H2;10H,4-6H2,1-3H3.
What are the key properties of azepane;triethoxysilane?
azepane;triethoxysilane has a molecular weight of 263.45 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azepane;triethoxysilane is sourced from PubChem (CID 173012109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).