About sulfane;triethoxysilane
sulfane;triethoxysilane (PubChem CID 173007277) has the molecular formula C6H24O3S4Si
and a molecular weight of 300.61 g/mol. Its IUPAC name is sulfane;triethoxysilane.
Molecular Properties
| Compound Name | sulfane;triethoxysilane |
| PubChem CID | 173007277 |
| Molecular Formula | C6H24O3S4Si |
| Molecular Weight | 300.61 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | sulfane;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.S.S.S.S |
| InChI | InChI=1S/C6H16O3Si.4H2S/c1-4-7-10(8-5-2)9-6-3;;;;/h10H,4-6H2,1-3H3;4*1H2 |
| InChIKey | NYTSVVMGHLNFMN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.61 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sulfane;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;triethoxysilane?
The IUPAC name of sulfane;triethoxysilane (CID 173007277) is sulfane;triethoxysilane.
What is the SMILES notation for sulfane;triethoxysilane?
The canonical SMILES for sulfane;triethoxysilane is CCO[SiH](OCC)OCC.S.S.S.S.
What is the InChIKey of sulfane;triethoxysilane?
The InChIKey is NYTSVVMGHLNFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.4H2S/c1-4-7-10(8-5-2)9-6-3;;;;/h10H,4-6H2,1-3H3;4*1H2.
What are the key properties of sulfane;triethoxysilane?
sulfane;triethoxysilane has a molecular weight of 300.61 g/mol, XLogP of 1.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;triethoxysilane is sourced from PubChem (CID 173007277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).