About ethane-1,2-diamine;triethoxysilane
ethane-1,2-diamine;triethoxysilane (PubChem CID 175110437) has the molecular formula C8H24N2O3Si
and a molecular weight of 224.38 g/mol. Its IUPAC name is ethane-1,2-diamine;triethoxysilane.
Molecular Properties
| Compound Name | ethane-1,2-diamine;triethoxysilane |
| PubChem CID | 175110437 |
| Molecular Formula | C8H24N2O3Si |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | ethane-1,2-diamine;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.NCCN |
| InChI | InChI=1S/C6H16O3Si.C2H8N2/c1-4-7-10(8-5-2)9-6-3;3-1-2-4/h10H,4-6H2,1-3H3;1-4H2 |
| InChIKey | KZBDGYKDXNHYRV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diamine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diamine;triethoxysilane?
The IUPAC name of ethane-1,2-diamine;triethoxysilane (CID 175110437) is ethane-1,2-diamine;triethoxysilane.
What is the SMILES notation for ethane-1,2-diamine;triethoxysilane?
The canonical SMILES for ethane-1,2-diamine;triethoxysilane is CCO[SiH](OCC)OCC.NCCN.
What is the InChIKey of ethane-1,2-diamine;triethoxysilane?
The InChIKey is KZBDGYKDXNHYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C2H8N2/c1-4-7-10(8-5-2)9-6-3;3-1-2-4/h10H,4-6H2,1-3H3;1-4H2.
What are the key properties of ethane-1,2-diamine;triethoxysilane?
ethane-1,2-diamine;triethoxysilane has a molecular weight of 224.38 g/mol, XLogP of -0.28, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diamine;triethoxysilane is sourced from PubChem (CID 175110437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).