C9H26N2O3Si — CID 173025805
N'-methylethane-1,2-diamine;triethoxysilane (PubChem CID 173025805) has the molecular formula C9H26N2O3Si and a molecular weight of 238.40 g/mol. Its IUPAC name is N'-methylethane-1,2-diamine;triethoxysilane.
| Compound Name | N'-methylethane-1,2-diamine;triethoxysilane |
|---|---|
| PubChem CID | 173025805 |
| Molecular Formula | C9H26N2O3Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N'-methylethane-1,2-diamine;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.CNCCN |
| InChI | InChI=1S/C6H16O3Si.C3H10N2/c1-4-7-10(8-5-2)9-6-3;1-5-3-2-4/h10H,4-6H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | ZKNNXVICSUHIRU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|