C15H38N2O3Si — CID 173033378
N'-methylethane-1,2-diamine;tributoxysilane (PubChem CID 173033378) has the molecular formula C15H38N2O3Si and a molecular weight of 322.57 g/mol. Its IUPAC name is N'-methylethane-1,2-diamine;tributoxysilane.
| Compound Name | N'-methylethane-1,2-diamine;tributoxysilane |
|---|---|
| PubChem CID | 173033378 |
| Molecular Formula | C15H38N2O3Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | N'-methylethane-1,2-diamine;tributoxysilane |
| SMILES | CCCCO[SiH](OCCCC)OCCCC.CNCCN |
| InChI | InChI=1S/C12H28O3Si.C3H10N2/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3;1-5-3-2-4/h16H,4-12H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | WNCIGBYFSYGVJP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|