About butoxy(diethoxy)silane;methanamine
butoxy(diethoxy)silane;methanamine (PubChem CID 173001020) has the molecular formula C9H25NO3Si
and a molecular weight of 223.39 g/mol. Its IUPAC name is butoxy(diethoxy)silane;methanamine.
Molecular Properties
| Compound Name | butoxy(diethoxy)silane;methanamine |
| PubChem CID | 173001020 |
| Molecular Formula | C9H25NO3Si |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | butoxy(diethoxy)silane;methanamine |
| SMILES | CCCCO[SiH](OCC)OCC.CN |
| InChI | InChI=1S/C8H20O3Si.CH5N/c1-4-7-8-11-12(9-5-2)10-6-3;1-2/h12H,4-8H2,1-3H3;2H2,1H3 |
| InChIKey | PAHIONOKPCBEAQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxy(diethoxy)silane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy(diethoxy)silane;methanamine?
The IUPAC name of butoxy(diethoxy)silane;methanamine (CID 173001020) is butoxy(diethoxy)silane;methanamine.
What is the SMILES notation for butoxy(diethoxy)silane;methanamine?
The canonical SMILES for butoxy(diethoxy)silane;methanamine is CCCCO[SiH](OCC)OCC.CN.
What is the InChIKey of butoxy(diethoxy)silane;methanamine?
The InChIKey is PAHIONOKPCBEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O3Si.CH5N/c1-4-7-8-11-12(9-5-2)10-6-3;1-2/h12H,4-8H2,1-3H3;2H2,1H3.
What are the key properties of butoxy(diethoxy)silane;methanamine?
butoxy(diethoxy)silane;methanamine has a molecular weight of 223.39 g/mol, XLogP of 1.17, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy(diethoxy)silane;methanamine is sourced from PubChem (CID 173001020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).