About fluoro hypofluorite;bis(triethoxysilane)
fluoro hypofluorite;bis(triethoxysilane) (PubChem CID 173332294) has the molecular formula C12H32F2O7Si2
and a molecular weight of 382.55 g/mol. Its IUPAC name is fluoro hypofluorite;bis(triethoxysilane).
Molecular Properties
| Compound Name | fluoro hypofluorite;bis(triethoxysilane) |
| PubChem CID | 173332294 |
| Molecular Formula | C12H32F2O7Si2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | fluoro hypofluorite;bis(triethoxysilane) |
| SMILES | CCO[SiH](OCC)OCC.CCO[SiH](OCC)OCC.FOF |
| InChI | InChI=1S/2C6H16O3Si.F2O/c2*1-4-7-10(8-5-2)9-6-3;1-3-2/h2*10H,4-6H2,1-3H3; |
| InChIKey | OLFCJMGJLNRMDT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoro hypofluorite;bis(triethoxysilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro hypofluorite;bis(triethoxysilane)?
The IUPAC name of fluoro hypofluorite;bis(triethoxysilane) (CID 173332294) is fluoro hypofluorite;bis(triethoxysilane).
What is the SMILES notation for fluoro hypofluorite;bis(triethoxysilane)?
The canonical SMILES for fluoro hypofluorite;bis(triethoxysilane) is CCO[SiH](OCC)OCC.CCO[SiH](OCC)OCC.FOF.
What is the InChIKey of fluoro hypofluorite;bis(triethoxysilane)?
The InChIKey is OLFCJMGJLNRMDT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H16O3Si.F2O/c2*1-4-7-10(8-5-2)9-6-3;1-3-2/h2*10H,4-6H2,1-3H3;.
What are the key properties of fluoro hypofluorite;bis(triethoxysilane)?
fluoro hypofluorite;bis(triethoxysilane) has a molecular weight of 382.55 g/mol, XLogP of 2.40, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro hypofluorite;bis(triethoxysilane) is sourced from PubChem (CID 173332294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).