About triethoxysilane;hydrochloride
triethoxysilane;hydrochloride (PubChem CID 162327780) has the molecular formula C6H17ClO3Si
and a molecular weight of 200.74 g/mol. Its IUPAC name is triethoxysilane;hydrochloride.
Molecular Properties
| Compound Name | triethoxysilane;hydrochloride |
| PubChem CID | 162327780 |
| Molecular Formula | C6H17ClO3Si |
| Molecular Weight | 200.74 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | triethoxysilane;hydrochloride |
| SMILES | CCO[SiH](OCC)OCC.Cl |
| InChI | InChI=1S/C6H16O3Si.ClH/c1-4-7-10(8-5-2)9-6-3;/h10H,4-6H2,1-3H3;1H |
| InChIKey | VVPKLKCGNVQIEZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.74 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxysilane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxysilane;hydrochloride?
The IUPAC name of triethoxysilane;hydrochloride (CID 162327780) is triethoxysilane;hydrochloride.
What is the SMILES notation for triethoxysilane;hydrochloride?
The canonical SMILES for triethoxysilane;hydrochloride is CCO[SiH](OCC)OCC.Cl.
What is the InChIKey of triethoxysilane;hydrochloride?
The InChIKey is VVPKLKCGNVQIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.ClH/c1-4-7-10(8-5-2)9-6-3;/h10H,4-6H2,1-3H3;1H.
What are the key properties of triethoxysilane;hydrochloride?
triethoxysilane;hydrochloride has a molecular weight of 200.74 g/mol, XLogP of 1.23, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxysilane;hydrochloride is sourced from PubChem (CID 162327780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).