About N-methylmethanamine;triethoxysilane
N-methylmethanamine;triethoxysilane (PubChem CID 173126402) has the molecular formula C8H23NO3Si
and a molecular weight of 209.36 g/mol. Its IUPAC name is N-methylmethanamine;triethoxysilane.
Molecular Properties
| Compound Name | N-methylmethanamine;triethoxysilane |
| PubChem CID | 173126402 |
| Molecular Formula | C8H23NO3Si |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-methylmethanamine;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.CNC |
| InChI | InChI=1S/C6H16O3Si.C2H7N/c1-4-7-10(8-5-2)9-6-3;1-3-2/h10H,4-6H2,1-3H3;3H,1-2H3 |
| InChIKey | JPLILYHIKAQUEV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;triethoxysilane?
The IUPAC name of N-methylmethanamine;triethoxysilane (CID 173126402) is N-methylmethanamine;triethoxysilane.
What is the SMILES notation for N-methylmethanamine;triethoxysilane?
The canonical SMILES for N-methylmethanamine;triethoxysilane is CCO[SiH](OCC)OCC.CNC.
What is the InChIKey of N-methylmethanamine;triethoxysilane?
The InChIKey is JPLILYHIKAQUEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C2H7N/c1-4-7-10(8-5-2)9-6-3;1-3-2/h10H,4-6H2,1-3H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;triethoxysilane?
N-methylmethanamine;triethoxysilane has a molecular weight of 209.36 g/mol, XLogP of 0.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;triethoxysilane is sourced from PubChem (CID 173126402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).