About dimethyl (Z)-but-2-enedioate;triethoxysilane
dimethyl (Z)-but-2-enedioate;triethoxysilane (PubChem CID 174885500) has the molecular formula C12H24O7Si
and a molecular weight of 308.40 g/mol. Its IUPAC name is dimethyl (Z)-but-2-enedioate;triethoxysilane.
Molecular Properties
| Compound Name | dimethyl (Z)-but-2-enedioate;triethoxysilane |
| PubChem CID | 174885500 |
| Molecular Formula | C12H24O7Si |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | dimethyl (Z)-but-2-enedioate;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.COC(=O)/C=C\C(=O)OC |
| InChI | InChI=1S/C6H8O4.C6H16O3Si/c1-9-5(7)3-4-6(8)10-2;1-4-7-10(8-5-2)9-6-3/h3-4H,1-2H3;10H,4-6H2,1-3H3/b4-3-; |
| InChIKey | OTEUVEBWAZQAJJ-LNKPDPKZSA-N |
| XLogP | 0.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-but-2-enedioate;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-but-2-enedioate;triethoxysilane?
The IUPAC name of dimethyl (Z)-but-2-enedioate;triethoxysilane (CID 174885500) is dimethyl (Z)-but-2-enedioate;triethoxysilane.
What is the SMILES notation for dimethyl (Z)-but-2-enedioate;triethoxysilane?
The canonical SMILES for dimethyl (Z)-but-2-enedioate;triethoxysilane is CCO[SiH](OCC)OCC.COC(=O)/C=C\C(=O)OC.
What is the InChIKey of dimethyl (Z)-but-2-enedioate;triethoxysilane?
The InChIKey is OTEUVEBWAZQAJJ-LNKPDPKZSA-N. The full InChI is InChI=1S/C6H8O4.C6H16O3Si/c1-9-5(7)3-4-6(8)10-2;1-4-7-10(8-5-2)9-6-3/h3-4H,1-2H3;10H,4-6H2,1-3H3/b4-3-;.
What are the key properties of dimethyl (Z)-but-2-enedioate;triethoxysilane?
dimethyl (Z)-but-2-enedioate;triethoxysilane has a molecular weight of 308.40 g/mol, XLogP of 0.70, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-but-2-enedioate;triethoxysilane is sourced from PubChem (CID 174885500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).