methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid

C6H10O5 — CID 174783551

IUPACmethanol;(Z)-4-methoxy-4-oxobut-2-enoic acid
SMILESCO.COC(=O)/C=C\C(=O)O
InChIInChI=1S/C5H6O4.CH4O/c1-9-5(8)3-2-4(6)7;1-2/h2-3H,1H3,(H,6,7);2H,1H3/b3-2-;
InChIKeyLLQXCWMUCBFZRG-OLGQORCHSA-N
MW162.14 g/mol
LogP-0.59
Rot. Bonds2

About methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid

methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid (PubChem CID 174783551) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid.

Molecular Properties

Compound Namemethanol;(Z)-4-methoxy-4-oxobut-2-enoic acid
PubChem CID174783551
Molecular FormulaC6H10O5
Molecular Weight162.14 g/mol
Exact Mass162.05
IUPAC Namemethanol;(Z)-4-methoxy-4-oxobut-2-enoic acid
SMILESCO.COC(=O)/C=C\C(=O)O
InChIInChI=1S/C5H6O4.CH4O/c1-9-5(8)3-2-4(6)7;1-2/h2-3H,1H3,(H,6,7);2H,1H3/b3-2-;
InChIKeyLLQXCWMUCBFZRG-OLGQORCHSA-N
XLogP-0.59
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.14
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid?
The IUPAC name of methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid (CID 174783551) is methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid.
What is the SMILES notation for methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid?
The canonical SMILES for methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid is CO.COC(=O)/C=C\C(=O)O.
What is the InChIKey of methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid?
The InChIKey is LLQXCWMUCBFZRG-OLGQORCHSA-N. The full InChI is InChI=1S/C5H6O4.CH4O/c1-9-5(8)3-2-4(6)7;1-2/h2-3H,1H3,(H,6,7);2H,1H3/b3-2-;.
What are the key properties of methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid?
methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid has a molecular weight of 162.14 g/mol, XLogP of -0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(Z)-4-methoxy-4-oxobut-2-enoic acid is sourced from PubChem (CID 174783551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).