C25H30O4 — CID 175795333
(2E,4Z,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid (PubChem CID 175795333) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (2E,4Z,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid.
| Compound Name | (2E,4Z,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
|---|---|
| PubChem CID | 175795333 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (2E,4Z,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
| SMILES | COC(=O)/C=C/C(C)=C\C=C\C(C)=C\C=CC=C(C)C=C/C=C(C)\C=C\C(=O)O |
| InChI | InChI=1S/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6?,12-8?,13-9+,18-16+,19-17+,20-10?,21-11+,22-14-,23-15- |
| InChIKey | RAFGELQLHMBRHD-PCGUZRNJSA-N |
| XLogP | 5.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|