C10H12O8 — CID 160537834
but-2-enedioic acid;dimethyl but-2-enedioate (PubChem CID 160537834) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is but-2-enedioic acid;dimethyl but-2-enedioate.
| Compound Name | but-2-enedioic acid;dimethyl but-2-enedioate |
|---|---|
| PubChem CID | 160537834 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | but-2-enedioic acid;dimethyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OC.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C6H8O4.C4H4O4/c1-9-5(7)3-4-6(8)10-2;5-3(6)1-2-4(7)8/h3-4H,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | QWJTVLCUPQWXQU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|