C10H12O8 — CID 174862788
(Z)-4-methoxy-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid (PubChem CID 174862788) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is (Z)-4-methoxy-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid.
| Compound Name | (Z)-4-methoxy-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 174862788 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (Z)-4-methoxy-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid |
| SMILES | C=C(CC(=O)O)C(=O)O.COC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/2C5H6O4/c1-9-5(8)3-2-4(6)7;1-3(5(8)9)2-4(6)7/h2-3H,1H3,(H,6,7);1-2H2,(H,6,7)(H,8,9)/b3-2-; |
| InChIKey | ADGLMLUWAXXIRR-OLGQORCHSA-N |
| XLogP | -0.10 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|