ethenoxyethene;2-methylidenebutanedioic acid

C9H12O5 — CID 159680731

IUPACethenoxyethene;2-methylidenebutanedioic acid
SMILESC=C(CC(=O)O)C(=O)O.C=COC=C
InChIInChI=1S/C5H6O4.C4H6O/c1-3(5(8)9)2-4(6)7;1-3-5-4-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2
InChIKeyMVEGINXOCCFBBX-UHFFFAOYSA-N
MW200.19 g/mol
LogP1.39
Rot. Bonds5

About ethenoxyethene;2-methylidenebutanedioic acid

ethenoxyethene;2-methylidenebutanedioic acid (PubChem CID 159680731) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is ethenoxyethene;2-methylidenebutanedioic acid.

Molecular Properties

Compound Nameethenoxyethene;2-methylidenebutanedioic acid
PubChem CID159680731
Molecular FormulaC9H12O5
Molecular Weight200.19 g/mol
Exact Mass200.07
IUPAC Nameethenoxyethene;2-methylidenebutanedioic acid
SMILESC=C(CC(=O)O)C(=O)O.C=COC=C
InChIInChI=1S/C5H6O4.C4H6O/c1-3(5(8)9)2-4(6)7;1-3-5-4-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2
InChIKeyMVEGINXOCCFBBX-UHFFFAOYSA-N
XLogP1.39
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethenoxyethene;2-methylidenebutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethene;ethenoxyethene;2-methylidenebutanedioic acid
CID 173139326
2-methylidenebutanedioic acid;zirconium
CID 158245785
methane;2-methylidenebutanedioic acid
CID 158038738
2-methylbuta-1,3-diene;2-methylidenebutanedioic acid
CID 162113299
potassium;sodium;hydride;2-methylidenebutanedioic acid
CID 174838643
azane;2-methylidenebutanedioic acid;methyl prop-2-enoate
CID 88746751
sodium;ethenyl sulfite;2-methylidenebutanedioic acid
CID 121346754
2-methylidenebutanedioic acid;prop-2-enyl prop-2-enoate
CID 87416560
1,1-dichloroethene;2-methylidenebutanedioic acid;methyl prop-2-enoate
CID 86751954
acetylene;2-methylidenebutanedioic acid;urea
CID 157377951
2-methylidenebutanedioic acid;trimethylazanium;chloride
CID 157060052
1,1-dichloroethene;2-methylidenebutanedioic acid;prop-2-enenitrile
CID 22662599

Frequently Asked Questions

What is the IUPAC name of ethenoxyethene;2-methylidenebutanedioic acid?
The IUPAC name of ethenoxyethene;2-methylidenebutanedioic acid (CID 159680731) is ethenoxyethene;2-methylidenebutanedioic acid.
What is the SMILES notation for ethenoxyethene;2-methylidenebutanedioic acid?
The canonical SMILES for ethenoxyethene;2-methylidenebutanedioic acid is C=C(CC(=O)O)C(=O)O.C=COC=C.
What is the InChIKey of ethenoxyethene;2-methylidenebutanedioic acid?
The InChIKey is MVEGINXOCCFBBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C4H6O/c1-3(5(8)9)2-4(6)7;1-3-5-4-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2.
What are the key properties of ethenoxyethene;2-methylidenebutanedioic acid?
ethenoxyethene;2-methylidenebutanedioic acid has a molecular weight of 200.19 g/mol, XLogP of 1.39, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;2-methylidenebutanedioic acid is sourced from PubChem (CID 159680731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).