C10H11Cl2NO4 — CID 22662599
1,1-dichloroethene;2-methylidenebutanedioic acid;prop-2-enenitrile (PubChem CID 22662599) has the molecular formula C10H11Cl2NO4 and a molecular weight of 280.11 g/mol. Its IUPAC name is 1,1-dichloroethene;2-methylidenebutanedioic acid;prop-2-enenitrile.
| Compound Name | 1,1-dichloroethene;2-methylidenebutanedioic acid;prop-2-enenitrile |
|---|---|
| PubChem CID | 22662599 |
| Molecular Formula | C10H11Cl2NO4 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 1,1-dichloroethene;2-methylidenebutanedioic acid;prop-2-enenitrile |
| SMILES | C=C(CC(=O)O)C(=O)O.C=C(Cl)Cl.C=CC#N |
| InChI | InChI=1S/C5H6O4.C3H3N.C2H2Cl2/c1-3(5(8)9)2-4(6)7;1-2-3-4;1-2(3)4/h1-2H2,(H,6,7)(H,8,9);2H,1H2;1H2 |
| InChIKey | AFBQXBNIXGTXHL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|