About 2-methylidenebutanedioic acid;trimethylazanium;chloride
2-methylidenebutanedioic acid;trimethylazanium;chloride (PubChem CID 157060052) has the molecular formula C8H16ClNO4
and a molecular weight of 225.67 g/mol. Its IUPAC name is 2-methylidenebutanedioic acid;trimethylazanium;chloride.
Molecular Properties
| Compound Name | 2-methylidenebutanedioic acid;trimethylazanium;chloride |
| PubChem CID | 157060052 |
| Molecular Formula | C8H16ClNO4 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-methylidenebutanedioic acid;trimethylazanium;chloride |
| SMILES | C=C(CC(=O)O)C(=O)O.C[NH+](C)C.[Cl-] |
| InChI | InChI=1S/C5H6O4.C3H9N.ClH/c1-3(5(8)9)2-4(6)7;1-4(2)3;/h1-2H2,(H,6,7)(H,8,9);1-3H3;1H |
| InChIKey | TXHUUZZBVAPJGC-UHFFFAOYSA-N |
| XLogP | -4.13 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanedioic acid;trimethylazanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanedioic acid;trimethylazanium;chloride?
The IUPAC name of 2-methylidenebutanedioic acid;trimethylazanium;chloride (CID 157060052) is 2-methylidenebutanedioic acid;trimethylazanium;chloride.
What is the SMILES notation for 2-methylidenebutanedioic acid;trimethylazanium;chloride?
The canonical SMILES for 2-methylidenebutanedioic acid;trimethylazanium;chloride is C=C(CC(=O)O)C(=O)O.C[NH+](C)C.[Cl-].
What is the InChIKey of 2-methylidenebutanedioic acid;trimethylazanium;chloride?
The InChIKey is TXHUUZZBVAPJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C3H9N.ClH/c1-3(5(8)9)2-4(6)7;1-4(2)3;/h1-2H2,(H,6,7)(H,8,9);1-3H3;1H.
What are the key properties of 2-methylidenebutanedioic acid;trimethylazanium;chloride?
2-methylidenebutanedioic acid;trimethylazanium;chloride has a molecular weight of 225.67 g/mol, XLogP of -4.13, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanedioic acid;trimethylazanium;chloride is sourced from PubChem (CID 157060052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).