About methane;2-methylidenebutanedioic acid
methane;2-methylidenebutanedioic acid (PubChem CID 158038738) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is methane;2-methylidenebutanedioic acid.
Molecular Properties
| Compound Name | methane;2-methylidenebutanedioic acid |
| PubChem CID | 158038738 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | methane;2-methylidenebutanedioic acid |
| SMILES | C.C=C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H6O4.CH4/c1-3(5(8)9)2-4(6)7;/h1-2H2,(H,6,7)(H,8,9);1H4 |
| InChIKey | IAQNXQMFAQLTBE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylidenebutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylidenebutanedioic acid?
The IUPAC name of methane;2-methylidenebutanedioic acid (CID 158038738) is methane;2-methylidenebutanedioic acid.
What is the SMILES notation for methane;2-methylidenebutanedioic acid?
The canonical SMILES for methane;2-methylidenebutanedioic acid is C.C=C(CC(=O)O)C(=O)O.
What is the InChIKey of methane;2-methylidenebutanedioic acid?
The InChIKey is IAQNXQMFAQLTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.CH4/c1-3(5(8)9)2-4(6)7;/h1-2H2,(H,6,7)(H,8,9);1H4.
What are the key properties of methane;2-methylidenebutanedioic acid?
methane;2-methylidenebutanedioic acid has a molecular weight of 146.14 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylidenebutanedioic acid is sourced from PubChem (CID 158038738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).