C11H20O8 — CID 159631548
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylidenebutanedioic acid (PubChem CID 159631548) has the molecular formula C11H20O8 and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylidenebutanedioic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 159631548 |
| Molecular Formula | C11H20O8 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-methylidenebutanedioic acid |
| SMILES | C=C(CC(=O)O)C(=O)O.OCCOCCOCCO |
| InChI | InChI=1S/C6H14O4.C5H6O4/c7-1-3-9-5-6-10-4-2-8;1-3(5(8)9)2-4(6)7/h7-8H,1-6H2;1-2H2,(H,6,7)(H,8,9) |
| InChIKey | MPEQDPIMAVAJCY-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|