About cycloheptylcycloheptane;2-methylidenebutanedioic acid
cycloheptylcycloheptane;2-methylidenebutanedioic acid (PubChem CID 175019086) has the molecular formula C19H32O4
and a molecular weight of 324.46 g/mol. Its IUPAC name is cycloheptylcycloheptane;2-methylidenebutanedioic acid.
Molecular Properties
| Compound Name | cycloheptylcycloheptane;2-methylidenebutanedioic acid |
| PubChem CID | 175019086 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | cycloheptylcycloheptane;2-methylidenebutanedioic acid |
| SMILES | C1CCCC(C2CCCCCC2)CC1.C=C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26.C5H6O4/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14;1-3(5(8)9)2-4(6)7/h13-14H,1-12H2;1-2H2,(H,6,7)(H,8,9) |
| InChIKey | IJYWWIPYZFBYFN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cycloheptylcycloheptane;2-methylidenebutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptylcycloheptane;2-methylidenebutanedioic acid?
The IUPAC name of cycloheptylcycloheptane;2-methylidenebutanedioic acid (CID 175019086) is cycloheptylcycloheptane;2-methylidenebutanedioic acid.
What is the SMILES notation for cycloheptylcycloheptane;2-methylidenebutanedioic acid?
The canonical SMILES for cycloheptylcycloheptane;2-methylidenebutanedioic acid is C1CCCC(C2CCCCCC2)CC1.C=C(CC(=O)O)C(=O)O.
What is the InChIKey of cycloheptylcycloheptane;2-methylidenebutanedioic acid?
The InChIKey is IJYWWIPYZFBYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26.C5H6O4/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14;1-3(5(8)9)2-4(6)7/h13-14H,1-12H2;1-2H2,(H,6,7)(H,8,9).
What are the key properties of cycloheptylcycloheptane;2-methylidenebutanedioic acid?
cycloheptylcycloheptane;2-methylidenebutanedioic acid has a molecular weight of 324.46 g/mol, XLogP of 5.03, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptylcycloheptane;2-methylidenebutanedioic acid is sourced from PubChem (CID 175019086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).