ethene;ethenoxyethene;2-methylidenebutanedioic acid

C13H20O5 — CID 173139326

IUPACethene;ethenoxyethene;2-methylidenebutanedioic acid
SMILESC=C.C=C.C=C(CC(=O)O)C(=O)O.C=COC=C
InChIInChI=1S/C5H6O4.C4H6O.2C2H4/c1-3(5(8)9)2-4(6)7;1-3-5-4-2;2*1-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2;2*1-2H2
InChIKeyILIJGKOSIIYUFZ-UHFFFAOYSA-N
MW256.30 g/mol
LogP3.00
Rot. Bonds5

About ethene;ethenoxyethene;2-methylidenebutanedioic acid

ethene;ethenoxyethene;2-methylidenebutanedioic acid (PubChem CID 173139326) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethene;ethenoxyethene;2-methylidenebutanedioic acid.

Molecular Properties

Compound Nameethene;ethenoxyethene;2-methylidenebutanedioic acid
PubChem CID173139326
Molecular FormulaC13H20O5
Molecular Weight256.30 g/mol
Exact Mass256.13
IUPAC Nameethene;ethenoxyethene;2-methylidenebutanedioic acid
SMILESC=C.C=C.C=C(CC(=O)O)C(=O)O.C=COC=C
InChIInChI=1S/C5H6O4.C4H6O.2C2H4/c1-3(5(8)9)2-4(6)7;1-3-5-4-2;2*1-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2;2*1-2H2
InChIKeyILIJGKOSIIYUFZ-UHFFFAOYSA-N
XLogP3.00
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 53.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethene;ethenoxyethene;2-methylidenebutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethene;ethenoxyethene;2-methylidenebutanedioic acid?
The IUPAC name of ethene;ethenoxyethene;2-methylidenebutanedioic acid (CID 173139326) is ethene;ethenoxyethene;2-methylidenebutanedioic acid.
What is the SMILES notation for ethene;ethenoxyethene;2-methylidenebutanedioic acid?
The canonical SMILES for ethene;ethenoxyethene;2-methylidenebutanedioic acid is C=C.C=C.C=C(CC(=O)O)C(=O)O.C=COC=C.
What is the InChIKey of ethene;ethenoxyethene;2-methylidenebutanedioic acid?
The InChIKey is ILIJGKOSIIYUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C4H6O.2C2H4/c1-3(5(8)9)2-4(6)7;1-3-5-4-2;2*1-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2;2*1-2H2.
What are the key properties of ethene;ethenoxyethene;2-methylidenebutanedioic acid?
ethene;ethenoxyethene;2-methylidenebutanedioic acid has a molecular weight of 256.30 g/mol, XLogP of 3.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethenoxyethene;2-methylidenebutanedioic acid is sourced from PubChem (CID 173139326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).