About ethene;ethenoxyethene;2-methylidenebutanedioic acid
ethene;ethenoxyethene;2-methylidenebutanedioic acid (PubChem CID 173139326) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is ethene;ethenoxyethene;2-methylidenebutanedioic acid.
Molecular Properties
| Compound Name | ethene;ethenoxyethene;2-methylidenebutanedioic acid |
| PubChem CID | 173139326 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethene;ethenoxyethene;2-methylidenebutanedioic acid |
| SMILES | C=C.C=C.C=C(CC(=O)O)C(=O)O.C=COC=C |
| InChI | InChI=1S/C5H6O4.C4H6O.2C2H4/c1-3(5(8)9)2-4(6)7;1-3-5-4-2;2*1-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2;2*1-2H2 |
| InChIKey | ILIJGKOSIIYUFZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;ethenoxyethene;2-methylidenebutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;ethenoxyethene;2-methylidenebutanedioic acid?
The IUPAC name of ethene;ethenoxyethene;2-methylidenebutanedioic acid (CID 173139326) is ethene;ethenoxyethene;2-methylidenebutanedioic acid.
What is the SMILES notation for ethene;ethenoxyethene;2-methylidenebutanedioic acid?
The canonical SMILES for ethene;ethenoxyethene;2-methylidenebutanedioic acid is C=C.C=C.C=C(CC(=O)O)C(=O)O.C=COC=C.
What is the InChIKey of ethene;ethenoxyethene;2-methylidenebutanedioic acid?
The InChIKey is ILIJGKOSIIYUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C4H6O.2C2H4/c1-3(5(8)9)2-4(6)7;1-3-5-4-2;2*1-2/h1-2H2,(H,6,7)(H,8,9);3-4H,1-2H2;2*1-2H2.
What are the key properties of ethene;ethenoxyethene;2-methylidenebutanedioic acid?
ethene;ethenoxyethene;2-methylidenebutanedioic acid has a molecular weight of 256.30 g/mol, XLogP of 3.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethenoxyethene;2-methylidenebutanedioic acid is sourced from PubChem (CID 173139326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).