C11H14Cl2O6 — CID 86751954
1,1-dichloroethene;2-methylidenebutanedioic acid;methyl prop-2-enoate (PubChem CID 86751954) has the molecular formula C11H14Cl2O6 and a molecular weight of 313.13 g/mol. Its IUPAC name is 1,1-dichloroethene;2-methylidenebutanedioic acid;methyl prop-2-enoate.
| Compound Name | 1,1-dichloroethene;2-methylidenebutanedioic acid;methyl prop-2-enoate |
|---|---|
| PubChem CID | 86751954 |
| Molecular Formula | C11H14Cl2O6 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1,1-dichloroethene;2-methylidenebutanedioic acid;methyl prop-2-enoate |
| SMILES | C=C(CC(=O)O)C(=O)O.C=C(Cl)Cl.C=CC(=O)OC |
| InChI | InChI=1S/C5H6O4.C4H6O2.C2H2Cl2/c1-3(5(8)9)2-4(6)7;1-3-4(5)6-2;1-2(3)4/h1-2H2,(H,6,7)(H,8,9);3H,1H2,2H3;1H2 |
| InChIKey | HATRZINXSXGGHD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|