C17H26O8 — CID 159097457
(Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid (PubChem CID 159097457) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is (Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid.
| Compound Name | (Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 159097457 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoic acid;2-methylidenebutanedioic acid |
| SMILES | C=C(CC(=O)O)C(=O)O.CCCCC(CC)COC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H20O4.C5H6O4/c1-3-5-6-10(4-2)9-16-12(15)8-7-11(13)14;1-3(5(8)9)2-4(6)7/h7-8,10H,3-6,9H2,1-2H3,(H,13,14);1-2H2,(H,6,7)(H,8,9)/b8-7-; |
| InChIKey | KCVRFZIAACEVGE-CFYXSCKTSA-N |
| XLogP | 2.49 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|