C16H22O7 — CID 174444791
(Z)-4-[(Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-4-oxobut-2-enoic acid (PubChem CID 174444791) has the molecular formula C16H22O7 and a molecular weight of 326.34 g/mol. Its IUPAC name is (Z)-4-[(Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 174444791 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (Z)-4-[(Z)-4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy-4-oxobut-2-enoic acid |
| SMILES | CCCCC(CC)COC(=O)/C=C\C(=O)OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H22O7/c1-3-5-6-12(4-2)11-22-14(19)9-10-16(21)23-15(20)8-7-13(17)18/h7-10,12H,3-6,11H2,1-2H3,(H,17,18)/b8-7-,10-9- |
| InChIKey | BCECMCFOMXUYDZ-QRLRYFCNSA-N |
| XLogP | 2.01 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|