About acetic acid;2-ethylhexyl acetate
acetic acid;2-ethylhexyl acetate (PubChem CID 159619780) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is acetic acid;2-ethylhexyl acetate.
Molecular Properties
| Compound Name | acetic acid;2-ethylhexyl acetate |
| PubChem CID | 159619780 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | acetic acid;2-ethylhexyl acetate |
| SMILES | CC(=O)O.CCCCC(CC)COC(C)=O |
| InChI | InChI=1S/C10H20O2.C2H4O2/c1-4-6-7-10(5-2)8-12-9(3)11;1-2(3)4/h10H,4-8H2,1-3H3;1H3,(H,3,4) |
| InChIKey | MNSZVQONJBYVIU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;2-ethylhexyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-ethylhexyl acetate?
The IUPAC name of acetic acid;2-ethylhexyl acetate (CID 159619780) is acetic acid;2-ethylhexyl acetate.
What is the SMILES notation for acetic acid;2-ethylhexyl acetate?
The canonical SMILES for acetic acid;2-ethylhexyl acetate is CC(=O)O.CCCCC(CC)COC(C)=O.
What is the InChIKey of acetic acid;2-ethylhexyl acetate?
The InChIKey is MNSZVQONJBYVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C2H4O2/c1-4-6-7-10(5-2)8-12-9(3)11;1-2(3)4/h10H,4-8H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-ethylhexyl acetate?
acetic acid;2-ethylhexyl acetate has a molecular weight of 232.32 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-ethylhexyl acetate is sourced from PubChem (CID 159619780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).