About 2-ethylhexyl 2-aminohexanoate
2-ethylhexyl 2-aminohexanoate (PubChem CID 61303871) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-ethylhexyl 2-aminohexanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 2-aminohexanoate |
| PubChem CID | 61303871 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2-ethylhexyl 2-aminohexanoate |
| SMILES | CCCCC(CC)COC(=O)C(N)CCCC |
| InChI | InChI=1S/C14H29NO2/c1-4-7-9-12(6-3)11-17-14(16)13(15)10-8-5-2/h12-13H,4-11,15H2,1-3H3 |
| InChIKey | DVEUKYPCJPXATI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylhexyl 2-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 2-aminohexanoate?
The IUPAC name of 2-ethylhexyl 2-aminohexanoate (CID 61303871) is 2-ethylhexyl 2-aminohexanoate.
What is the SMILES notation for 2-ethylhexyl 2-aminohexanoate?
The canonical SMILES for 2-ethylhexyl 2-aminohexanoate is CCCCC(CC)COC(=O)C(N)CCCC.
What is the InChIKey of 2-ethylhexyl 2-aminohexanoate?
The InChIKey is DVEUKYPCJPXATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-4-7-9-12(6-3)11-17-14(16)13(15)10-8-5-2/h12-13H,4-11,15H2,1-3H3.
What are the key properties of 2-ethylhexyl 2-aminohexanoate?
2-ethylhexyl 2-aminohexanoate has a molecular weight of 243.39 g/mol, XLogP of 3.26, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-aminohexanoate is sourced from PubChem (CID 61303871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).