About [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate
[(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate (PubChem CID 94863795) has the molecular formula C18H34O6
and a molecular weight of 346.46 g/mol. Its IUPAC name is [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate.
Molecular Properties
| Compound Name | [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate |
| PubChem CID | 94863795 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate |
| SMILES | CCCC[C@@H](CC)COC(=O)OOC(=O)OC[C@@H](CC)CCCC |
| InChI | InChI=1S/C18H34O6/c1-5-9-11-15(7-3)13-21-17(19)23-24-18(20)22-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3/t15-,16+ |
| InChIKey | ZACVGCNKGYYQHA-IYBDPMFKSA-N |
| XLogP | 5.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate?
The IUPAC name of [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate (CID 94863795) is [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate.
What is the SMILES notation for [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate?
The canonical SMILES for [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate is CCCC[C@@H](CC)COC(=O)OOC(=O)OC[C@@H](CC)CCCC.
What is the InChIKey of [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate?
The InChIKey is ZACVGCNKGYYQHA-IYBDPMFKSA-N. The full InChI is InChI=1S/C18H34O6/c1-5-9-11-15(7-3)13-21-17(19)23-24-18(20)22-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3/t15-,16+.
What are the key properties of [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate?
[(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate has a molecular weight of 346.46 g/mol, XLogP of 5.64, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-ethylhexoxy]carbonyloxy [(2S)-2-ethylhexyl] carbonate is sourced from PubChem (CID 94863795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).