About [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate
[ethyl(dimethyl)silyl] 2-ethylhexyl carbonate (PubChem CID 155712729) has the molecular formula C13H28O3Si
and a molecular weight of 260.45 g/mol. Its IUPAC name is [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate.
Molecular Properties
| Compound Name | [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate |
| PubChem CID | 155712729 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate |
| SMILES | CCCCC(CC)COC(=O)O[Si](C)(C)CC |
| InChI | InChI=1S/C13H28O3Si/c1-6-9-10-12(7-2)11-15-13(14)16-17(4,5)8-3/h12H,6-11H2,1-5H3 |
| InChIKey | XJAFNMRLQGWEDQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate?
The IUPAC name of [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate (CID 155712729) is [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate.
What is the SMILES notation for [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate?
The canonical SMILES for [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate is CCCCC(CC)COC(=O)O[Si](C)(C)CC.
What is the InChIKey of [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate?
The InChIKey is XJAFNMRLQGWEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3Si/c1-6-9-10-12(7-2)11-15-13(14)16-17(4,5)8-3/h12H,6-11H2,1-5H3.
What are the key properties of [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate?
[ethyl(dimethyl)silyl] 2-ethylhexyl carbonate has a molecular weight of 260.45 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl(dimethyl)silyl] 2-ethylhexyl carbonate is sourced from PubChem (CID 155712729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).