About 2-ethylhexyl prop-2-enyl carbonate
2-ethylhexyl prop-2-enyl carbonate (PubChem CID 91693070) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-ethylhexyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | 2-ethylhexyl prop-2-enyl carbonate |
| PubChem CID | 91693070 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-ethylhexyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C12H22O3/c1-4-7-8-11(6-3)10-15-12(13)14-9-5-2/h5,11H,2,4,6-10H2,1,3H3 |
| InChIKey | RAEACIVHTRRGPZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl prop-2-enyl carbonate?
The IUPAC name of 2-ethylhexyl prop-2-enyl carbonate (CID 91693070) is 2-ethylhexyl prop-2-enyl carbonate.
What is the SMILES notation for 2-ethylhexyl prop-2-enyl carbonate?
The canonical SMILES for 2-ethylhexyl prop-2-enyl carbonate is C=CCOC(=O)OCC(CC)CCCC.
What is the InChIKey of 2-ethylhexyl prop-2-enyl carbonate?
The InChIKey is RAEACIVHTRRGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-4-7-8-11(6-3)10-15-12(13)14-9-5-2/h5,11H,2,4,6-10H2,1,3H3.
What are the key properties of 2-ethylhexyl prop-2-enyl carbonate?
2-ethylhexyl prop-2-enyl carbonate has a molecular weight of 214.30 g/mol, XLogP of 3.54, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl prop-2-enyl carbonate is sourced from PubChem (CID 91693070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).