C23H48O5 — CID 160953382
bis(2-ethylhexyl) carbonate;2,2-dimethylbutane-1,1-diol (PubChem CID 160953382) has the molecular formula C23H48O5 and a molecular weight of 404.63 g/mol. Its IUPAC name is bis(2-ethylhexyl) carbonate;2,2-dimethylbutane-1,1-diol.
| Compound Name | bis(2-ethylhexyl) carbonate;2,2-dimethylbutane-1,1-diol |
|---|---|
| PubChem CID | 160953382 |
| Molecular Formula | C23H48O5 |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | bis(2-ethylhexyl) carbonate;2,2-dimethylbutane-1,1-diol |
| SMILES | CCC(C)(C)C(O)O.CCCCC(CC)COC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C17H34O3.C6H14O2/c1-5-9-11-15(7-3)13-19-17(18)20-14-16(8-4)12-10-6-2;1-4-6(2,3)5(7)8/h15-16H,5-14H2,1-4H3;5,7-8H,4H2,1-3H3 |
| InChIKey | SWBDMWYAKKGYGN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|