C14H26O5 — CID 87194850
2-ethylhexyl 2,4-dihydroxy-2-methyl-3-oxopentanoate (PubChem CID 87194850) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-ethylhexyl 2,4-dihydroxy-2-methyl-3-oxopentanoate.
| Compound Name | 2-ethylhexyl 2,4-dihydroxy-2-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 87194850 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-ethylhexyl 2,4-dihydroxy-2-methyl-3-oxopentanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)(O)C(=O)C(C)O |
| InChI | InChI=1S/C14H26O5/c1-5-7-8-11(6-2)9-19-13(17)14(4,18)12(16)10(3)15/h10-11,15,18H,5-9H2,1-4H3 |
| InChIKey | GJYJQQBZWZHIKP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|