C21H42O2 — CID 123332449
2-ethylhexyl 5,5-dimethyl-2-(2-methylbutan-2-yl)hexanoate (PubChem CID 123332449) has the molecular formula C21H42O2 and a molecular weight of 326.57 g/mol. Its IUPAC name is 2-ethylhexyl 5,5-dimethyl-2-(2-methylbutan-2-yl)hexanoate.
| Compound Name | 2-ethylhexyl 5,5-dimethyl-2-(2-methylbutan-2-yl)hexanoate |
|---|---|
| PubChem CID | 123332449 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | 2-ethylhexyl 5,5-dimethyl-2-(2-methylbutan-2-yl)hexanoate |
| SMILES | CCCCC(CC)COC(=O)C(CCC(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C21H42O2/c1-9-12-13-17(10-2)16-23-19(22)18(21(7,8)11-3)14-15-20(4,5)6/h17-18H,9-16H2,1-8H3 |
| InChIKey | IVBVGSCJGFDWCN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |