C36H70O6 — CID 141390199
2-ethylhexyl 2-[1-(2-ethylhexoxy)-7,7-dimethyl-1-oxooctan-2-yl]peroxy-7,7-dimethyloctanoate (PubChem CID 141390199) has the molecular formula C36H70O6 and a molecular weight of 598.95 g/mol. Its IUPAC name is 2-ethylhexyl 2-[1-(2-ethylhexoxy)-7,7-dimethyl-1-oxooctan-2-yl]peroxy-7,7-dimethyloctanoate.
| Compound Name | 2-ethylhexyl 2-[1-(2-ethylhexoxy)-7,7-dimethyl-1-oxooctan-2-yl]peroxy-7,7-dimethyloctanoate |
|---|---|
| PubChem CID | 141390199 |
| Molecular Formula | C36H70O6 |
| Molecular Weight | 598.95 g/mol |
| Exact Mass | 598.52 |
| IUPAC Name | 2-ethylhexyl 2-[1-(2-ethylhexoxy)-7,7-dimethyl-1-oxooctan-2-yl]peroxy-7,7-dimethyloctanoate |
| SMILES | CCCCC(CC)COC(=O)C(CCCCC(C)(C)C)OOC(CCCCC(C)(C)C)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C36H70O6/c1-11-15-21-29(13-3)27-39-33(37)31(23-17-19-25-35(5,6)7)41-42-32(24-18-20-26-36(8,9)10)34(38)40-28-30(14-4)22-16-12-2/h29-32H,11-28H2,1-10H3 |
| InChIKey | YCQSFVVSLVZLFS-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.95 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|