C28H54O4Sn — CID 141254644
bis[(2-butyl-7,7-dimethyloctanoyl)oxy]tin (PubChem CID 141254644) has the molecular formula C28H54O4Sn and a molecular weight of 573.45 g/mol. Its IUPAC name is bis[(2-butyl-7,7-dimethyloctanoyl)oxy]tin.
| Compound Name | bis[(2-butyl-7,7-dimethyloctanoyl)oxy]tin |
|---|---|
| PubChem CID | 141254644 |
| Molecular Formula | C28H54O4Sn |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | bis[(2-butyl-7,7-dimethyloctanoyl)oxy]tin |
| SMILES | CCCCC(CCCCC(C)(C)C)C(=O)O[Sn]OC(=O)C(CCCC)CCCCC(C)(C)C |
| InChI | InChI=1S/2C14H28O2.Sn/c2*1-5-6-9-12(13(15)16)10-7-8-11-14(2,3)4;/h2*12H,5-11H2,1-4H3,(H,15,16);/q;;+2/p-2 |
| InChIKey | MVRZRWUCXQSQDZ-UHFFFAOYSA-L |
| XLogP | 8.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|