C18H34O4Pb — CID 71300519
7,7-dimethyloctanoyloxy(2-ethylhexanoyloxy)lead (PubChem CID 71300519) has the molecular formula C18H34O4Pb and a molecular weight of 521.67 g/mol. Its IUPAC name is 7,7-dimethyloctanoyloxy(2-ethylhexanoyloxy)lead.
| Compound Name | 7,7-dimethyloctanoyloxy(2-ethylhexanoyloxy)lead |
|---|---|
| PubChem CID | 71300519 |
| Molecular Formula | C18H34O4Pb |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 7,7-dimethyloctanoyloxy(2-ethylhexanoyloxy)lead |
| SMILES | CCCCC(CC)C(=O)O[Pb]OC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C10H20O2.C8H16O2.Pb/c1-10(2,3)8-6-4-5-7-9(11)12;1-3-5-6-7(4-2)8(9)10;/h4-8H2,1-3H3,(H,11,12);7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | OLQFFKPSKUTQIA-UHFFFAOYSA-L |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|