About butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate
butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate (PubChem CID 122553511) has the molecular formula C28H52O12
and a molecular weight of 580.71 g/mol. Its IUPAC name is butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate.
Molecular Properties
| Compound Name | butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate |
| PubChem CID | 122553511 |
| Molecular Formula | C28H52O12 |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate |
| SMILES | CCC(C)OC(=O)OOC(=O)OC(C)CC.CCCCC(CC)COC(=O)OOC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C18H34O6.C10H18O6/c1-5-9-11-15(7-3)13-21-17(19)23-24-18(20)22-14-16(8-4)12-10-6-2;1-5-7(3)13-9(11)15-16-10(12)14-8(4)6-2/h15-16H,5-14H2,1-4H3;7-8H,5-6H2,1-4H3 |
| InChIKey | OWWJJBTYJQCTQH-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate?
The IUPAC name of butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate (CID 122553511) is butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate.
What is the SMILES notation for butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate?
The canonical SMILES for butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate is CCC(C)OC(=O)OOC(=O)OC(C)CC.CCCCC(CC)COC(=O)OOC(=O)OCC(CC)CCCC.
What is the InChIKey of butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate?
The InChIKey is OWWJJBTYJQCTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O6.C10H18O6/c1-5-9-11-15(7-3)13-21-17(19)23-24-18(20)22-14-16(8-4)12-10-6-2;1-5-7(3)13-9(11)15-16-10(12)14-8(4)6-2/h15-16H,5-14H2,1-4H3;7-8H,5-6H2,1-4H3.
What are the key properties of butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate?
butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate has a molecular weight of 580.71 g/mol, XLogP of 8.45, 16 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl butan-2-yloxycarbonyloxy carbonate;2-ethylhexoxycarbonyloxy 2-ethylhexyl carbonate is sourced from PubChem (CID 122553511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).