C39H74O12 — CID 59502807
2-[1,3-bis[1-(2-ethylhexoxycarbonyloxy)propan-2-yloxy]propan-2-yloxy]propyl 2-ethylhexyl carbonate (PubChem CID 59502807) has the molecular formula C39H74O12 and a molecular weight of 735.01 g/mol. Its IUPAC name is 2-[1,3-bis[1-(2-ethylhexoxycarbonyloxy)propan-2-yloxy]propan-2-yloxy]propyl 2-ethylhexyl carbonate.
| Compound Name | 2-[1,3-bis[1-(2-ethylhexoxycarbonyloxy)propan-2-yloxy]propan-2-yloxy]propyl 2-ethylhexyl carbonate |
|---|---|
| PubChem CID | 59502807 |
| Molecular Formula | C39H74O12 |
| Molecular Weight | 735.01 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | 2-[1,3-bis[1-(2-ethylhexoxycarbonyloxy)propan-2-yloxy]propan-2-yloxy]propyl 2-ethylhexyl carbonate |
| SMILES | CCCCC(CC)COC(=O)OCC(C)OCC(COC(C)COC(=O)OCC(CC)CCCC)OC(C)COC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C39H74O12/c1-10-16-19-33(13-4)25-48-37(40)45-22-30(7)43-28-36(51-32(9)24-47-39(42)50-27-35(15-6)21-18-12-3)29-44-31(8)23-46-38(41)49-26-34(14-5)20-17-11-2/h30-36H,10-29H2,1-9H3 |
| InChIKey | DXYPKCTUNQOISO-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.01 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|