C17H34O6 — CID 177094279
1-(2-ethylhexoxy)propan-2-yl 2-(2-hydroxyethoxy)propyl carbonate (PubChem CID 177094279) has the molecular formula C17H34O6 and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-(2-ethylhexoxy)propan-2-yl 2-(2-hydroxyethoxy)propyl carbonate.
| Compound Name | 1-(2-ethylhexoxy)propan-2-yl 2-(2-hydroxyethoxy)propyl carbonate |
|---|---|
| PubChem CID | 177094279 |
| Molecular Formula | C17H34O6 |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-(2-ethylhexoxy)propan-2-yl 2-(2-hydroxyethoxy)propyl carbonate |
| SMILES | CCCCC(CC)COCC(C)OC(=O)OCC(C)OCCO |
| InChI | InChI=1S/C17H34O6/c1-5-7-8-16(6-2)13-20-11-15(4)23-17(19)22-12-14(3)21-10-9-18/h14-16,18H,5-13H2,1-4H3 |
| InChIKey | SVMXGVKCSNNXFD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |