C23H45NO6 — CID 121473987
2-[1-[1-(2-ethylhexoxy)propan-2-yloxy]propan-2-yloxycarbonylamino]ethyl 2,2-dimethylbutanoate (PubChem CID 121473987) has the molecular formula C23H45NO6 and a molecular weight of 431.61 g/mol. Its IUPAC name is 2-[1-[1-(2-ethylhexoxy)propan-2-yloxy]propan-2-yloxycarbonylamino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[1-[1-(2-ethylhexoxy)propan-2-yloxy]propan-2-yloxycarbonylamino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 121473987 |
| Molecular Formula | C23H45NO6 |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | 2-[1-[1-(2-ethylhexoxy)propan-2-yloxy]propan-2-yloxycarbonylamino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCCCC(CC)COCC(C)OCC(C)OC(=O)NCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C23H45NO6/c1-8-11-12-20(9-2)17-27-15-18(4)29-16-19(5)30-22(26)24-13-14-28-21(25)23(6,7)10-3/h18-20H,8-17H2,1-7H3,(H,24,26) |
| InChIKey | NMBQHCHHOZVEHV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|