C29H58O4 — CID 90910622
2-ethylhexyl 2,2-dimethylbutanoate;nonan-3-yl 2,2-dimethylbutanoate (PubChem CID 90910622) has the molecular formula C29H58O4 and a molecular weight of 470.78 g/mol. Its IUPAC name is 2-ethylhexyl 2,2-dimethylbutanoate;nonan-3-yl 2,2-dimethylbutanoate.
| Compound Name | 2-ethylhexyl 2,2-dimethylbutanoate;nonan-3-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90910622 |
| Molecular Formula | C29H58O4 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.43 |
| IUPAC Name | 2-ethylhexyl 2,2-dimethylbutanoate;nonan-3-yl 2,2-dimethylbutanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)(C)CC.CCCCCCC(CC)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C15H30O2.C14H28O2/c1-6-9-10-11-12-13(7-2)17-14(16)15(4,5)8-3;1-6-9-10-12(7-2)11-16-13(15)14(4,5)8-3/h13H,6-12H2,1-5H3;12H,6-11H2,1-5H3 |
| InChIKey | FZWNYAIPUHIVBO-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|