About 2-ethylhexyl 3-sulfanylprop-2-enoate
2-ethylhexyl 3-sulfanylprop-2-enoate (PubChem CID 175439862) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 2-ethylhexyl 3-sulfanylprop-2-enoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 3-sulfanylprop-2-enoate |
| PubChem CID | 175439862 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-ethylhexyl 3-sulfanylprop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C=CS |
| InChI | InChI=1S/C11H20O2S/c1-3-5-6-10(4-2)9-13-11(12)7-8-14/h7-8,10,14H,3-6,9H2,1-2H3 |
| InChIKey | ABULHGNFGHDLCP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 3-sulfanylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 3-sulfanylprop-2-enoate?
The IUPAC name of 2-ethylhexyl 3-sulfanylprop-2-enoate (CID 175439862) is 2-ethylhexyl 3-sulfanylprop-2-enoate.
What is the SMILES notation for 2-ethylhexyl 3-sulfanylprop-2-enoate?
The canonical SMILES for 2-ethylhexyl 3-sulfanylprop-2-enoate is CCCCC(CC)COC(=O)C=CS.
What is the InChIKey of 2-ethylhexyl 3-sulfanylprop-2-enoate?
The InChIKey is ABULHGNFGHDLCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-3-5-6-10(4-2)9-13-11(12)7-8-14/h7-8,10,14H,3-6,9H2,1-2H3.
What are the key properties of 2-ethylhexyl 3-sulfanylprop-2-enoate?
2-ethylhexyl 3-sulfanylprop-2-enoate has a molecular weight of 216.35 g/mol, XLogP of 3.19, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 3-sulfanylprop-2-enoate is sourced from PubChem (CID 175439862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).