2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid

C16H28O4 — CID 134325468

IUPAC2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid
SMILESC=C(CC)C(=O)OCC(CC)CCCC.C=CC(=O)O
InChIInChI=1S/C13H24O2.C3H4O2/c1-5-8-9-12(7-3)10-15-13(14)11(4)6-2;1-2-3(4)5/h12H,4-10H2,1-3H3;2H,1H2,(H,4,5)
InChIKeyKSPUJPNFMOEYQM-UHFFFAOYSA-N
MW284.40 g/mol
LogP3.97
Rot. Bonds9

About 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid

2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid (PubChem CID 134325468) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid.

Molecular Properties

Compound Name2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid
PubChem CID134325468
Molecular FormulaC16H28O4
Molecular Weight284.40 g/mol
Exact Mass284.20
IUPAC Name2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid
SMILESC=C(CC)C(=O)OCC(CC)CCCC.C=CC(=O)O
InChIInChI=1S/C13H24O2.C3H4O2/c1-5-8-9-12(7-3)10-15-13(14)11(4)6-2;1-2-3(4)5/h12H,4-10H2,1-3H3;2H,1H2,(H,4,5)
InChIKeyKSPUJPNFMOEYQM-UHFFFAOYSA-N
XLogP3.97
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 53.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid?
The IUPAC name of 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid (CID 134325468) is 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid.
What is the SMILES notation for 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid?
The canonical SMILES for 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid is C=C(CC)C(=O)OCC(CC)CCCC.C=CC(=O)O.
What is the InChIKey of 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid?
The InChIKey is KSPUJPNFMOEYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2.C3H4O2/c1-5-8-9-12(7-3)10-15-13(14)11(4)6-2;1-2-3(4)5/h12H,4-10H2,1-3H3;2H,1H2,(H,4,5).
What are the key properties of 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid?
2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid has a molecular weight of 284.40 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2-methylidenebutanoate;prop-2-enoic acid is sourced from PubChem (CID 134325468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).