C38H60O12 — CID 173249539
4-butoxycarbonylpenta-2,4-dienoic acid;butyl prop-2-enoate;2-ethylhexyl prop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid (PubChem CID 173249539) has the molecular formula C38H60O12 and a molecular weight of 708.89 g/mol. Its IUPAC name is 4-butoxycarbonylpenta-2,4-dienoic acid;butyl prop-2-enoate;2-ethylhexyl prop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid.
| Compound Name | 4-butoxycarbonylpenta-2,4-dienoic acid;butyl prop-2-enoate;2-ethylhexyl prop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173249539 |
| Molecular Formula | C38H60O12 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.41 |
| IUPAC Name | 4-butoxycarbonylpenta-2,4-dienoic acid;butyl prop-2-enoate;2-ethylhexyl prop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid |
| SMILES | C=C(C=CC(=O)O)C(=O)OCC(C)C.C=C(C=CC(=O)O)C(=O)OCCCC.C=CC(=O)OCC(CC)CCCC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C11H20O2.2C10H14O4.C7H12O2/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-7(2)6-14-10(13)8(3)4-5-9(11)12;1-3-4-7-14-10(13)8(2)5-6-9(11)12;1-3-5-6-9-7(8)4-2/h6,10H,3-5,7-9H2,1-2H3;4-5,7H,3,6H2,1-2H3,(H,11,12);5-6H,2-4,7H2,1H3,(H,11,12);4H,2-3,5-6H2,1H3 |
| InChIKey | ALRGZZKOFQMCFL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|