C17H30O4 — CID 88771560
butyl 2-methylprop-2-enoate;2-ethylbutyl prop-2-enoate (PubChem CID 88771560) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-ethylbutyl prop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;2-ethylbutyl prop-2-enoate |
|---|---|
| PubChem CID | 88771560 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-ethylbutyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC.C=CC(=O)OCC(CC)CC |
| InChI | InChI=1S/C9H16O2.C8H14O2/c1-4-8(5-2)7-11-9(10)6-3;1-4-5-6-10-8(9)7(2)3/h6,8H,3-5,7H2,1-2H3;2,4-6H2,1,3H3 |
| InChIKey | DIUDGGKKKRISKQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|