buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid

C14H20O4 — CID 88761421

IUPACbuta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid
SMILESC=C(C=CC(=O)O)C(=O)OCCCC.C=CC=C
InChIInChI=1S/C10H14O4.C4H6/c1-3-4-7-14-10(13)8(2)5-6-9(11)12;1-3-4-2/h5-6H,2-4,7H2,1H3,(H,11,12);3-4H,1-2H2
InChIKeyJMXAPENXXBLMOX-UHFFFAOYSA-N
MW252.31 g/mol
LogP2.89
Rot. Bonds7

About buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid

buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid (PubChem CID 88761421) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid.

Molecular Properties

Compound Namebuta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid
PubChem CID88761421
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Namebuta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid
SMILESC=C(C=CC(=O)O)C(=O)OCCCC.C=CC=C
InChIInChI=1S/C10H14O4.C4H6/c1-3-4-7-14-10(13)8(2)5-6-9(11)12;1-3-4-2/h5-6H,2-4,7H2,1H3,(H,11,12);3-4H,1-2H2
InChIKeyJMXAPENXXBLMOX-UHFFFAOYSA-N
XLogP2.89
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid?
The IUPAC name of buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid (CID 88761421) is buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid.
What is the SMILES notation for buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid?
The canonical SMILES for buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid is C=C(C=CC(=O)O)C(=O)OCCCC.C=CC=C.
What is the InChIKey of buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid?
The InChIKey is JMXAPENXXBLMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.C4H6/c1-3-4-7-14-10(13)8(2)5-6-9(11)12;1-3-4-2/h5-6H,2-4,7H2,1H3,(H,11,12);3-4H,1-2H2.
What are the key properties of buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid?
buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid has a molecular weight of 252.31 g/mol, XLogP of 2.89, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;4-butoxycarbonylpenta-2,4-dienoic acid is sourced from PubChem (CID 88761421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).