About (Z)-but-2-enedioic acid;hex-1-ene
(Z)-but-2-enedioic acid;hex-1-ene (PubChem CID 88803963) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;hex-1-ene.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;hex-1-ene |
| PubChem CID | 88803963 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (Z)-but-2-enedioic acid;hex-1-ene |
| SMILES | C=CCCCC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H12.C4H4O4/c1-3-5-6-4-2;5-3(6)1-2-4(7)8/h3H,1,4-6H2,2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GJJWCENBMJAIHZ-BTJKTKAUSA-N |
| XLogP | 2.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;hex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;hex-1-ene?
The IUPAC name of (Z)-but-2-enedioic acid;hex-1-ene (CID 88803963) is (Z)-but-2-enedioic acid;hex-1-ene.
What is the SMILES notation for (Z)-but-2-enedioic acid;hex-1-ene?
The canonical SMILES for (Z)-but-2-enedioic acid;hex-1-ene is C=CCCCC.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;hex-1-ene?
The InChIKey is GJJWCENBMJAIHZ-BTJKTKAUSA-N. The full InChI is InChI=1S/C6H12.C4H4O4/c1-3-5-6-4-2;5-3(6)1-2-4(7)8/h3H,1,4-6H2,2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;hex-1-ene?
(Z)-but-2-enedioic acid;hex-1-ene has a molecular weight of 200.23 g/mol, XLogP of 2.07, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;hex-1-ene is sourced from PubChem (CID 88803963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).