C19H30O6 — CID 87522811
4-butoxycarbonyl-2-ethylpenta-2,4-dienoic acid;butyl prop-2-enoate (PubChem CID 87522811) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-butoxycarbonyl-2-ethylpenta-2,4-dienoic acid;butyl prop-2-enoate.
| Compound Name | 4-butoxycarbonyl-2-ethylpenta-2,4-dienoic acid;butyl prop-2-enoate |
|---|---|
| PubChem CID | 87522811 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-butoxycarbonyl-2-ethylpenta-2,4-dienoic acid;butyl prop-2-enoate |
| SMILES | C=C(C=C(CC)C(=O)O)C(=O)OCCCC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C12H18O4.C7H12O2/c1-4-6-7-16-12(15)9(3)8-10(5-2)11(13)14;1-3-5-6-9-7(8)4-2/h8H,3-7H2,1-2H3,(H,13,14);4H,2-3,5-6H2,1H3 |
| InChIKey | YSVGHMAOJWBQQW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|