C24H46O10 — CID 175496622
2-ethylhexyl 2-methylprop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid (PubChem CID 175496622) has the molecular formula C24H46O10 and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-ethylhexyl 2-methylprop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid.
| Compound Name | 2-ethylhexyl 2-methylprop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 175496622 |
| Molecular Formula | C24H46O10 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC(CC)CCCC.C=CC(=O)O.COC(O)COCCOCCOCCO |
| InChI | InChI=1S/C12H22O2.C9H20O6.C3H4O2/c1-5-7-8-11(6-2)9-14-12(13)10(3)4;1-12-9(11)8-15-7-6-14-5-4-13-3-2-10;1-2-3(4)5/h11H,3,5-9H2,1-2,4H3;9-11H,2-8H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | SGUZXFUDCXPNIQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|