C22H44O8 — CID 175496624
decyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol (PubChem CID 175496624) has the molecular formula C22H44O8 and a molecular weight of 436.59 g/mol. Its IUPAC name is decyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol.
| Compound Name | decyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol |
|---|---|
| PubChem CID | 175496624 |
| Molecular Formula | C22H44O8 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | decyl prop-2-enoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-1-methoxyethanol |
| SMILES | C=CC(=O)OCCCCCCCCCC.COC(O)COCCOCCOCCO |
| InChI | InChI=1S/C13H24O2.C9H20O6/c1-3-5-6-7-8-9-10-11-12-15-13(14)4-2;1-12-9(11)8-15-7-6-14-5-4-13-3-2-10/h4H,2-3,5-12H2,1H3;9-11H,2-8H2,1H3 |
| InChIKey | XUWRRVWDMFLRJI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|