C19H38O7 — CID 175496640
2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;nonyl prop-2-enoate (PubChem CID 175496640) has the molecular formula C19H38O7 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;nonyl prop-2-enoate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;nonyl prop-2-enoate |
|---|---|
| PubChem CID | 175496640 |
| Molecular Formula | C19H38O7 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;nonyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCC.COC(O)COCCOCCO |
| InChI | InChI=1S/C12H22O2.C7H16O5/c1-3-5-6-7-8-9-10-11-14-12(13)4-2;1-10-7(9)6-12-5-4-11-3-2-8/h4H,2-3,5-11H2,1H3;7-9H,2-6H2,1H3 |
| InChIKey | WLJZEJKENNIXMS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|